Zadanie 5f, Paper 2, specimen 2025, Chemia IB HL
Wzorowane na: Chemistry HL Paper 2, specimen 2025, pytanie 5(f). Treść, dane i kontekst są zmienione; sprawdzane umiejętności, format i punktacja jak w oryginale.
Darmowe konto pozwoli wrócić do niego później.
Zadanie
Wspólne informacje do wiązki zadań
Pentadecane, C15H32, is a component of diesel fuel and is also produced naturally by some cyanobacteria.
Polecenie
Butan-2-ol reacts with octadecanoic (stearic) acid to form an ester that is used as a lubricant.
C17H35COOH(l) + CH3CH(OH)CH2CH3(l) ⇌ C17H35COOCH(CH3)CH2CH3(l) + X(l)
(i) Identify the by-product X(l) and state the type of reaction taking place.
(ii) Calculate the atom economy for the formation of the ester.
(iii) Discuss why manufacturers take the atom economy into account when assessing the impact of an industrial reaction.
(iv) Treating the system as homogeneous, deduce the expression for the equilibrium constant, Kc, of this reaction.
Korepetytor AI
Nie wiesz, jak ruszyć? Korepetytor zna to zadanie i poprowadzi Cię krok po kroku, bez gotowca.
3 rozmowy · bez karty · Zaloguj się
Sprawdź się
Odpowiedz i oceń, jak poszło. Klucz odsłoń dopiero, gdy masz swoją odpowiedź.
Zanim porównasz z kluczem
Jak poszło Ci z tym zadaniem?
Zaloguj się, żeby zapisać ocenę i wrócić do zadania później.
Pokaż rozwiązanieUkryj rozwiązanieKlucz i punktacja
Odpowiedź z klucza
(i) condensation / esterification AND H2O / water ✔
(ii) «M(ester) = 22(12.01) + 44(1.01) + 2(16.00) = 340.66; M(H2O) = 18.02»
atom economy = « × 100 =» 95.0 % ✔
(iii) Any two of:
a high atom economy means that most of the atoms in the reactants end up in the useful product, so raw materials are used efficiently ✔
less waste / by-product is formed, which lowers disposal costs and environmental impact ✔
the process is more economical ✔
the process is more sustainable / conserves resources ✔
(iv) ✔
Schemat punktowania
(i) [1]: both the reaction type and water required. (ii) [1]: 95.0 % (accept 94.9–95.0 %). (iii) [2 max]. (iv) [1]: accept [X] in place of [H2O]; all four concentrations required, water must not be omitted.
Komentarz. The ester is the desired product, so its molar mass goes in the numerator; the atom economy is high because the only by-product is water.