Zadania z chemii IB HL

One route to 2-bromopropane is the substitution of propane by bromine in ultraviolet light. $\ce{C3H8(g) + Br2(g) -> C3H7Br(g) + HBr(g)}$ ($\ce{C3H8}$ = 44.11 $\mathrm{g\,mol^{-1}}$, $\ce{Br2}$ = 159.80 $\mathrm{g\,mol^{-1}}$, $\ce{C3H7Br}$ = 123.00…

For the overall reaction shown above, calculate the atom economy of this route from propane and ethane to propyl ethanoate. Use sections 1 and 7 of the data booklet.

(i) If the reaction has a percentage yield of 80 %, calculate the mass, in g, of benzene that would be produced from 2.0 kg of cyclohexane. (ii) Calculate the atom economy for this reaction, as a percentage.

Butan-2-ol reacts with octadecanoic (stearic) acid to form an ester that is used as a lubricant. $\ce{C17H35COOH(l) + CH3CH(OH)CH2CH3(l) <=> C17H35COOCH(CH3)CH2CH3(l) + X(l)}$ (i) Identify the by-product X(l) and state the type of reaction taking place. (ii)…